C3H2F6NO4S2+ — CID 174728763
4,4,5,5,6,6-hexafluoro-3,3-dihydroxydithiazinan-3-ium 1,1-dioxide (PubChem CID 174728763) has the molecular formula C3H2F6NO4S2+ and a molecular weight of 294.17 g/mol. Its IUPAC name is 4,4,5,5,6,6-hexafluoro-3,3-dihydroxydithiazinan-3-ium 1,1-dioxide.
| Compound Name | 4,4,5,5,6,6-hexafluoro-3,3-dihydroxydithiazinan-3-ium 1,1-dioxide |
|---|---|
| PubChem CID | 174728763 |
| Molecular Formula | C3H2F6NO4S2+ |
| Molecular Weight | 294.17 g/mol |
| Exact Mass | 293.93 |
| IUPAC Name | 4,4,5,5,6,6-hexafluoro-3,3-dihydroxydithiazinan-3-ium 1,1-dioxide |
| SMILES | O=S1(=O)S[N+](O)(O)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C3H2F6NO4S2/c4-1(5)2(6,7)10(11,12)15-16(13,14)3(1,8)9/h11-12H/q+1 |
| InChIKey | SYIYLVYNRTYVKF-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.17 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|