C4H4F5NO4S2 — CID 58341496
4,4,5,5,6-pentafluoro-6-methyl-1,3,2-dithiazinane 1,1,3,3-tetraoxide (PubChem CID 58341496) has the molecular formula C4H4F5NO4S2 and a molecular weight of 289.20 g/mol. Its IUPAC name is 4,4,5,5,6-pentafluoro-6-methyl-1,3,2-dithiazinane 1,1,3,3-tetraoxide.
| Compound Name | 4,4,5,5,6-pentafluoro-6-methyl-1,3,2-dithiazinane 1,1,3,3-tetraoxide |
|---|---|
| PubChem CID | 58341496 |
| Molecular Formula | C4H4F5NO4S2 |
| Molecular Weight | 289.20 g/mol |
| Exact Mass | 288.95 |
| IUPAC Name | 4,4,5,5,6-pentafluoro-6-methyl-1,3,2-dithiazinane 1,1,3,3-tetraoxide |
| SMILES | CC1(F)C(F)(F)C(F)(F)S(=O)(=O)NS1(=O)=O |
| InChI | InChI=1S/C4H4F5NO4S2/c1-2(5)3(6,7)4(8,9)16(13,14)10-15(2,11)12/h10H,1H3 |
| InChIKey | LXCLCGCDWDHDKO-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.20 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|