C4H3F5O5S2 — CID 163546247
3,3,4,4,5-pentafluoro-5-methyl-1,2,6-oxadithiane 2,2,6,6-tetraoxide (PubChem CID 163546247) has the molecular formula C4H3F5O5S2 and a molecular weight of 290.19 g/mol. Its IUPAC name is 3,3,4,4,5-pentafluoro-5-methyl-1,2,6-oxadithiane 2,2,6,6-tetraoxide.
| Compound Name | 3,3,4,4,5-pentafluoro-5-methyl-1,2,6-oxadithiane 2,2,6,6-tetraoxide |
|---|---|
| PubChem CID | 163546247 |
| Molecular Formula | C4H3F5O5S2 |
| Molecular Weight | 290.19 g/mol |
| Exact Mass | 289.93 |
| IUPAC Name | 3,3,4,4,5-pentafluoro-5-methyl-1,2,6-oxadithiane 2,2,6,6-tetraoxide |
| SMILES | CC1(F)C(F)(F)C(F)(F)S(=O)(=O)OS1(=O)=O |
| InChI | InChI=1S/C4H3F5O5S2/c1-2(5)3(6,7)4(8,9)16(12,13)14-15(2,10)11/h1H3 |
| InChIKey | MUGXUCQHUMUKPI-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.19 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|