C5F10O5S2 — CID 54080609
3,3,4,4,5,5,6,6,7,7-decafluoro-1,2,8-oxadithiocane 2,2,8,8-tetraoxide (PubChem CID 54080609) has the molecular formula C5F10O5S2 and a molecular weight of 394.16 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7-decafluoro-1,2,8-oxadithiocane 2,2,8,8-tetraoxide.
| Compound Name | 3,3,4,4,5,5,6,6,7,7-decafluoro-1,2,8-oxadithiocane 2,2,8,8-tetraoxide |
|---|---|
| PubChem CID | 54080609 |
| Molecular Formula | C5F10O5S2 |
| Molecular Weight | 394.16 g/mol |
| Exact Mass | 393.90 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7-decafluoro-1,2,8-oxadithiocane 2,2,8,8-tetraoxide |
| SMILES | O=S1(=O)OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C5F10O5S2/c6-1(7)2(8,9)4(12,13)21(16,17)20-22(18,19)5(14,15)3(1,10)11 |
| InChIKey | MMVJIQVSASMVGY-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.16 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|