C2F4LiNO4S2 — CID 14123337
lithium 4,4,5,5-tetrafluoro-1lambda6,3lambda6-dithia-2-azanidacyclopentane 1,1,3,3-tetraoxide (PubChem CID 14123337) has the molecular formula C2F4LiNO4S2 and a molecular weight of 249.09 g/mol. Its IUPAC name is lithium 4,4,5,5-tetrafluoro-1lambda6,3lambda6-dithia-2-azanidacyclopentane 1,1,3,3-tetraoxide.
| Compound Name | lithium 4,4,5,5-tetrafluoro-1lambda6,3lambda6-dithia-2-azanidacyclopentane 1,1,3,3-tetraoxide |
|---|---|
| PubChem CID | 14123337 |
| Molecular Formula | C2F4LiNO4S2 |
| Molecular Weight | 249.09 g/mol |
| Exact Mass | 248.94 |
| IUPAC Name | lithium 4,4,5,5-tetrafluoro-1lambda6,3lambda6-dithia-2-azanidacyclopentane 1,1,3,3-tetraoxide |
| SMILES | O=S1(=O)[N-]S(=O)(=O)C(F)(F)C1(F)F.[Li+] |
| InChI | InChI=1S/C2F4NO4S2.Li/c3-1(4)2(5,6)13(10,11)7-12(1,8)9;/q-1;+1 |
| InChIKey | BAYWSWNWVYTRTI-UHFFFAOYSA-N |
| XLogP | -2.78 |
| TPSA | 82.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.09 |
| LogP ≤ 5 | -2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|