C4H4F4NO2S- — CID 58040802
5,5,6,6-tetrafluoro-1λ6-thia-2-azanidacyclohexane 1,1-dioxide (PubChem CID 58040802) has the molecular formula C4H4F4NO2S- and a molecular weight of 206.14 g/mol. Its IUPAC name is 5,5,6,6-tetrafluoro-1λ6-thia-2-azanidacyclohexane 1,1-dioxide.
| Compound Name | 5,5,6,6-tetrafluoro-1λ6-thia-2-azanidacyclohexane 1,1-dioxide |
|---|---|
| PubChem CID | 58040802 |
| Molecular Formula | C4H4F4NO2S- |
| Molecular Weight | 206.14 g/mol |
| Exact Mass | 205.99 |
| IUPAC Name | 5,5,6,6-tetrafluoro-1λ6-thia-2-azanidacyclohexane 1,1-dioxide |
| SMILES | O=S1(=O)[N-]CCC(F)(F)C1(F)F |
| InChI | InChI=1S/C4H4F4NO2S/c5-3(6)1-2-9-12(10,11)4(3,7)8/h1-2H2/q-1 |
| InChIKey | QVMVVROGKJAPCR-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 48.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.14 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|