C8H13F2NO2S — CID 115034951
4,4-difluoro-8λ6-thia-1-azaspiro[4.5]decane 8,8-dioxide (PubChem CID 115034951) has the molecular formula C8H13F2NO2S and a molecular weight of 225.26 g/mol. Its IUPAC name is 4,4-difluoro-8λ6-thia-1-azaspiro[4.5]decane 8,8-dioxide.
| Compound Name | 4,4-difluoro-8λ6-thia-1-azaspiro[4.5]decane 8,8-dioxide |
|---|---|
| PubChem CID | 115034951 |
| Molecular Formula | C8H13F2NO2S |
| Molecular Weight | 225.26 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 4,4-difluoro-8λ6-thia-1-azaspiro[4.5]decane 8,8-dioxide |
| SMILES | O=S1(=O)CCC2(CC1)NCCC2(F)F |
| InChI | InChI=1S/C8H13F2NO2S/c9-8(10)1-4-11-7(8)2-5-14(12,13)6-3-7/h11H,1-6H2 |
| InChIKey | FVCBYFKVCXUYIJ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.26 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |