About 8λ6-thia-1-azaspiro[3.5]nonane 8,8-dioxide;hydrochloride
8λ6-thia-1-azaspiro[3.5]nonane 8,8-dioxide;hydrochloride (PubChem CID 138040668) has the molecular formula C7H14ClNO2S
and a molecular weight of 211.71 g/mol. Its IUPAC name is 8λ6-thia-1-azaspiro[3.5]nonane 8,8-dioxide;hydrochloride.
Analyze 8λ6-thia-1-azaspiro[3.5]nonane 8,8-dioxide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8λ6-thia-1-azaspiro[3.5]nonane 8,8-dioxide;hydrochloride?
The IUPAC name of 8λ6-thia-1-azaspiro[3.5]nonane 8,8-dioxide;hydrochloride (CID 138040668) is 8λ6-thia-1-azaspiro[3.5]nonane 8,8-dioxide;hydrochloride.
What is the SMILES notation for 8λ6-thia-1-azaspiro[3.5]nonane 8,8-dioxide;hydrochloride?
The canonical SMILES for 8λ6-thia-1-azaspiro[3.5]nonane 8,8-dioxide;hydrochloride is Cl.O=S1(=O)CCCC2(CCN2)C1.
What is the InChIKey of 8λ6-thia-1-azaspiro[3.5]nonane 8,8-dioxide;hydrochloride?
The InChIKey is ZZUNAQWMJDWQPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2S.ClH/c9-11(10)5-1-2-7(6-11)3-4-8-7;/h8H,1-6H2;1H.
What are the key properties of 8λ6-thia-1-azaspiro[3.5]nonane 8,8-dioxide;hydrochloride?
8λ6-thia-1-azaspiro[3.5]nonane 8,8-dioxide;hydrochloride has a molecular weight of 211.71 g/mol, XLogP of 0.35, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8λ6-thia-1-azaspiro[3.5]nonane 8,8-dioxide;hydrochloride is sourced from PubChem (CID 138040668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).