About (6R)-8λ6-thia-1-azaspiro[5.5]undecane 8,8-dioxide
(6R)-8λ6-thia-1-azaspiro[5.5]undecane 8,8-dioxide (PubChem CID 124505621) has the molecular formula C9H17NO2S
and a molecular weight of 203.31 g/mol. Its IUPAC name is (6R)-8λ6-thia-1-azaspiro[5.5]undecane 8,8-dioxide.
Molecular Properties
| Compound Name | (6R)-8λ6-thia-1-azaspiro[5.5]undecane 8,8-dioxide |
| PubChem CID | 124505621 |
| Molecular Formula | C9H17NO2S |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.10 |
| IUPAC Name | (6R)-8λ6-thia-1-azaspiro[5.5]undecane 8,8-dioxide |
| SMILES | O=S1(=O)CCC[C@]2(CCCCN2)C1 |
| InChI | InChI=1S/C9H17NO2S/c11-13(12)7-3-5-9(8-13)4-1-2-6-10-9/h10H,1-8H2/t9-/m1/s1 |
| InChIKey | ZWBOZCNQTBOOSI-SECBINFHSA-N |
| XLogP | 0.71 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (6R)-8λ6-thia-1-azaspiro[5.5]undecane 8,8-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-8λ6-thia-1-azaspiro[5.5]undecane 8,8-dioxide?
The IUPAC name of (6R)-8λ6-thia-1-azaspiro[5.5]undecane 8,8-dioxide (CID 124505621) is (6R)-8λ6-thia-1-azaspiro[5.5]undecane 8,8-dioxide.
What is the SMILES notation for (6R)-8λ6-thia-1-azaspiro[5.5]undecane 8,8-dioxide?
The canonical SMILES for (6R)-8λ6-thia-1-azaspiro[5.5]undecane 8,8-dioxide is O=S1(=O)CCC[C@]2(CCCCN2)C1.
What is the InChIKey of (6R)-8λ6-thia-1-azaspiro[5.5]undecane 8,8-dioxide?
The InChIKey is ZWBOZCNQTBOOSI-SECBINFHSA-N. The full InChI is InChI=1S/C9H17NO2S/c11-13(12)7-3-5-9(8-13)4-1-2-6-10-9/h10H,1-8H2/t9-/m1/s1.
What are the key properties of (6R)-8λ6-thia-1-azaspiro[5.5]undecane 8,8-dioxide?
(6R)-8λ6-thia-1-azaspiro[5.5]undecane 8,8-dioxide has a molecular weight of 203.31 g/mol, XLogP of 0.71, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-8λ6-thia-1-azaspiro[5.5]undecane 8,8-dioxide is sourced from PubChem (CID 124505621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).