C6H11NO2S — CID 124509901
(4S)-7λ6-thia-1-azaspiro[3.4]octane 7,7-dioxide (PubChem CID 124509901) has the molecular formula C6H11NO2S and a molecular weight of 161.23 g/mol. Its IUPAC name is (4S)-7λ6-thia-1-azaspiro[3.4]octane 7,7-dioxide.
| Compound Name | (4S)-7λ6-thia-1-azaspiro[3.4]octane 7,7-dioxide |
|---|---|
| PubChem CID | 124509901 |
| Molecular Formula | C6H11NO2S |
| Molecular Weight | 161.23 g/mol |
| Exact Mass | 161.05 |
| IUPAC Name | (4S)-7λ6-thia-1-azaspiro[3.4]octane 7,7-dioxide |
| SMILES | O=S1(=O)CC[C@@]2(CCN2)C1 |
| InChI | InChI=1S/C6H11NO2S/c8-10(9)4-2-6(5-10)1-3-7-6/h7H,1-5H2/t6-/m0/s1 |
| InChIKey | SGZORFSHPUFKAH-LURJTMIESA-N |
| XLogP | -0.46 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.23 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |