C8H14FNO2S — CID 115025157
9-fluoro-2λ6-thia-6-azaspiro[4.5]decane 2,2-dioxide (PubChem CID 115025157) has the molecular formula C8H14FNO2S and a molecular weight of 207.27 g/mol. Its IUPAC name is 9-fluoro-2λ6-thia-6-azaspiro[4.5]decane 2,2-dioxide.
| Compound Name | 9-fluoro-2λ6-thia-6-azaspiro[4.5]decane 2,2-dioxide |
|---|---|
| PubChem CID | 115025157 |
| Molecular Formula | C8H14FNO2S |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | 9-fluoro-2λ6-thia-6-azaspiro[4.5]decane 2,2-dioxide |
| SMILES | O=S1(=O)CCC2(CC(F)CCN2)C1 |
| InChI | InChI=1S/C8H14FNO2S/c9-7-1-3-10-8(5-7)2-4-13(11,12)6-8/h7,10H,1-6H2 |
| InChIKey | VGISANJEZCKODS-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |