C8H15FN2 — CID 115012372
9-fluoro-2,6-diazaspiro[4.5]decane (PubChem CID 115012372) has the molecular formula C8H15FN2 and a molecular weight of 158.22 g/mol. Its IUPAC name is 9-fluoro-2,6-diazaspiro[4.5]decane.
| Compound Name | 9-fluoro-2,6-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 115012372 |
| Molecular Formula | C8H15FN2 |
| Molecular Weight | 158.22 g/mol |
| Exact Mass | 158.12 |
| IUPAC Name | 9-fluoro-2,6-diazaspiro[4.5]decane |
| SMILES | FC1CCNC2(CCNC2)C1 |
| InChI | InChI=1S/C8H15FN2/c9-7-1-3-11-8(5-7)2-4-10-6-8/h7,10-11H,1-6H2 |
| InChIKey | VULCBIUVXDGNRE-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.22 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |