C7H14ClFN2 — CID 115015794
4-fluoro-1,7-diazaspiro[4.4]nonane;hydrochloride (PubChem CID 115015794) has the molecular formula C7H14ClFN2 and a molecular weight of 180.65 g/mol. Its IUPAC name is 4-fluoro-1,7-diazaspiro[4.4]nonane;hydrochloride.
| Compound Name | 4-fluoro-1,7-diazaspiro[4.4]nonane;hydrochloride |
|---|---|
| PubChem CID | 115015794 |
| Molecular Formula | C7H14ClFN2 |
| Molecular Weight | 180.65 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 4-fluoro-1,7-diazaspiro[4.4]nonane;hydrochloride |
| SMILES | Cl.FC1CCNC12CCNC2 |
| InChI | InChI=1S/C7H13FN2.ClH/c8-6-1-3-10-7(6)2-4-9-5-7;/h6,9-10H,1-5H2;1H |
| InChIKey | CPTLJRWAFRGIEI-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.65 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |