C8H16N2O — CID 115012188
2,6-diazaspiro[4.5]decan-10-ol (PubChem CID 115012188) has the molecular formula C8H16N2O and a molecular weight of 156.23 g/mol. Its IUPAC name is 2,6-diazaspiro[4.5]decan-10-ol.
| Compound Name | 2,6-diazaspiro[4.5]decan-10-ol |
|---|---|
| PubChem CID | 115012188 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | 2,6-diazaspiro[4.5]decan-10-ol |
| SMILES | OC1CCCNC12CCNC2 |
| InChI | InChI=1S/C8H16N2O/c11-7-2-1-4-10-8(7)3-5-9-6-8/h7,9-11H,1-6H2 |
| InChIKey | DRLZPZZAMSBXEA-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |