About 8-azaspiro[4.5]decane-1,4-diol
8-azaspiro[4.5]decane-1,4-diol (PubChem CID 141113779) has the molecular formula C9H17NO2
and a molecular weight of 171.24 g/mol. Its IUPAC name is 8-azaspiro[4.5]decane-1,4-diol.
Molecular Properties
| Compound Name | 8-azaspiro[4.5]decane-1,4-diol |
| PubChem CID | 141113779 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | 8-azaspiro[4.5]decane-1,4-diol |
| SMILES | OC1CCC(O)C12CCNCC2 |
| InChI | InChI=1S/C9H17NO2/c11-7-1-2-8(12)9(7)3-5-10-6-4-9/h7-8,10-12H,1-6H2 |
| InChIKey | CTDLJRCTAPRJBM-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-azaspiro[4.5]decane-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-azaspiro[4.5]decane-1,4-diol?
The IUPAC name of 8-azaspiro[4.5]decane-1,4-diol (CID 141113779) is 8-azaspiro[4.5]decane-1,4-diol.
What is the SMILES notation for 8-azaspiro[4.5]decane-1,4-diol?
The canonical SMILES for 8-azaspiro[4.5]decane-1,4-diol is OC1CCC(O)C12CCNCC2.
What is the InChIKey of 8-azaspiro[4.5]decane-1,4-diol?
The InChIKey is CTDLJRCTAPRJBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2/c11-7-1-2-8(12)9(7)3-5-10-6-4-9/h7-8,10-12H,1-6H2.
What are the key properties of 8-azaspiro[4.5]decane-1,4-diol?
8-azaspiro[4.5]decane-1,4-diol has a molecular weight of 171.24 g/mol, XLogP of -0.13, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-azaspiro[4.5]decane-1,4-diol is sourced from PubChem (CID 141113779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).