C6H13N2P — CID 155319775
4,7-diazaspiro[2.5]octan-2-ylphosphane (PubChem CID 155319775) has the molecular formula C6H13N2P and a molecular weight of 144.16 g/mol. Its IUPAC name is 4,7-diazaspiro[2.5]octan-2-ylphosphane.
| Compound Name | 4,7-diazaspiro[2.5]octan-2-ylphosphane |
|---|---|
| PubChem CID | 155319775 |
| Molecular Formula | C6H13N2P |
| Molecular Weight | 144.16 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | 4,7-diazaspiro[2.5]octan-2-ylphosphane |
| SMILES | PC1CC12CNCCN2 |
| InChI | InChI=1S/C6H13N2P/c9-5-3-6(5)4-7-1-2-8-6/h5,7-8H,1-4,9H2 |
| InChIKey | VJGGRZDZSWFPPV-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.16 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|