C6H13N3 — CID 23135285
1,5,8-triazaspiro[2.6]nonane (PubChem CID 23135285) has the molecular formula C6H13N3 and a molecular weight of 127.19 g/mol. Its IUPAC name is 1,5,8-triazaspiro[2.6]nonane.
| Compound Name | 1,5,8-triazaspiro[2.6]nonane |
|---|---|
| PubChem CID | 23135285 |
| Molecular Formula | C6H13N3 |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.11 |
| IUPAC Name | 1,5,8-triazaspiro[2.6]nonane |
| SMILES | C1CNCC2(CN1)CN2 |
| InChI | InChI=1S/C6H13N3/c1-2-8-4-6(3-7-1)5-9-6/h7-9H,1-5H2 |
| InChIKey | ARFFJTJMIRIHAF-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|