About 1,7-diazaspiro[3.4]octane;molecular hydrogen;propane
1,7-diazaspiro[3.4]octane;molecular hydrogen;propane (PubChem CID 171101355) has the molecular formula C9H22N2
and a molecular weight of 158.29 g/mol. Its IUPAC name is 1,7-diazaspiro[3.4]octane;molecular hydrogen;propane.
Molecular Properties
| Compound Name | 1,7-diazaspiro[3.4]octane;molecular hydrogen;propane |
| PubChem CID | 171101355 |
| Molecular Formula | C9H22N2 |
| Molecular Weight | 158.29 g/mol |
| Exact Mass | 158.18 |
| IUPAC Name | 1,7-diazaspiro[3.4]octane;molecular hydrogen;propane |
| SMILES | C1CC2(CCN2)CN1.CCC.[H][H] |
| InChI | InChI=1S/C6H12N2.C3H8.H2/c1-3-7-5-6(1)2-4-8-6;1-3-2;/h7-8H,1-5H2;3H2,1-2H3;1H |
| InChIKey | RXLXTYHIGNUMFD-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.29 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,7-diazaspiro[3.4]octane;molecular hydrogen;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,7-diazaspiro[3.4]octane;molecular hydrogen;propane?
The IUPAC name of 1,7-diazaspiro[3.4]octane;molecular hydrogen;propane (CID 171101355) is 1,7-diazaspiro[3.4]octane;molecular hydrogen;propane.
What is the SMILES notation for 1,7-diazaspiro[3.4]octane;molecular hydrogen;propane?
The canonical SMILES for 1,7-diazaspiro[3.4]octane;molecular hydrogen;propane is C1CC2(CCN2)CN1.CCC.[H][H].
What is the InChIKey of 1,7-diazaspiro[3.4]octane;molecular hydrogen;propane?
The InChIKey is RXLXTYHIGNUMFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2.C3H8.H2/c1-3-7-5-6(1)2-4-8-6;1-3-2;/h7-8H,1-5H2;3H2,1-2H3;1H.
What are the key properties of 1,7-diazaspiro[3.4]octane;molecular hydrogen;propane?
1,7-diazaspiro[3.4]octane;molecular hydrogen;propane has a molecular weight of 158.29 g/mol, XLogP of 1.37, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,7-diazaspiro[3.4]octane;molecular hydrogen;propane is sourced from PubChem (CID 171101355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).