About 1-azaspiro[2.6]nonane;propane
1-azaspiro[2.6]nonane;propane (PubChem CID 171101466) has the molecular formula C11H23N
and a molecular weight of 169.31 g/mol. Its IUPAC name is 1-azaspiro[2.6]nonane;propane.
Molecular Properties
| Compound Name | 1-azaspiro[2.6]nonane;propane |
| PubChem CID | 171101466 |
| Molecular Formula | C11H23N |
| Molecular Weight | 169.31 g/mol |
| Exact Mass | 169.18 |
| IUPAC Name | 1-azaspiro[2.6]nonane;propane |
| SMILES | C1CCCC2(CC1)CN2.CCC |
| InChI | InChI=1S/C8H15N.C3H8/c1-2-4-6-8(5-3-1)7-9-8;1-3-2/h9H,1-7H2;3H2,1-2H3 |
| InChIKey | GKLNYGOHLTYVSS-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 21.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-azaspiro[2.6]nonane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azaspiro[2.6]nonane;propane?
The IUPAC name of 1-azaspiro[2.6]nonane;propane (CID 171101466) is 1-azaspiro[2.6]nonane;propane.
What is the SMILES notation for 1-azaspiro[2.6]nonane;propane?
The canonical SMILES for 1-azaspiro[2.6]nonane;propane is C1CCCC2(CC1)CN2.CCC.
What is the InChIKey of 1-azaspiro[2.6]nonane;propane?
The InChIKey is GKLNYGOHLTYVSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N.C3H8/c1-2-4-6-8(5-3-1)7-9-8;1-3-2/h9H,1-7H2;3H2,1-2H3.
What are the key properties of 1-azaspiro[2.6]nonane;propane?
1-azaspiro[2.6]nonane;propane has a molecular weight of 169.31 g/mol, XLogP of 3.10, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azaspiro[2.6]nonane;propane is sourced from PubChem (CID 171101466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).