About cesium;carbanide;4,7-diazaspiro[2.5]octane
cesium;carbanide;4,7-diazaspiro[2.5]octane (PubChem CID 168976829) has the molecular formula C7H15CsN2
and a molecular weight of 260.12 g/mol. Its IUPAC name is cesium;carbanide;4,7-diazaspiro[2.5]octane.
Molecular Properties
| Compound Name | cesium;carbanide;4,7-diazaspiro[2.5]octane |
| PubChem CID | 168976829 |
| Molecular Formula | C7H15CsN2 |
| Molecular Weight | 260.12 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | cesium;carbanide;4,7-diazaspiro[2.5]octane |
| SMILES | C1CNC2(CC2)CN1.[CH3-].[Cs+] |
| InChI | InChI=1S/C6H12N2.CH3.Cs/c1-2-6(1)5-7-3-4-8-6;;/h7-8H,1-5H2;1H3;/q;-1;+1 |
| InChIKey | ISJOGPZBULJJTI-UHFFFAOYSA-N |
| XLogP | -2.83 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.12 |
| LogP ≤ 5 | -2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze cesium;carbanide;4,7-diazaspiro[2.5]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cesium;carbanide;4,7-diazaspiro[2.5]octane?
The IUPAC name of cesium;carbanide;4,7-diazaspiro[2.5]octane (CID 168976829) is cesium;carbanide;4,7-diazaspiro[2.5]octane.
What is the SMILES notation for cesium;carbanide;4,7-diazaspiro[2.5]octane?
The canonical SMILES for cesium;carbanide;4,7-diazaspiro[2.5]octane is C1CNC2(CC2)CN1.[CH3-].[Cs+].
What is the InChIKey of cesium;carbanide;4,7-diazaspiro[2.5]octane?
The InChIKey is ISJOGPZBULJJTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2.CH3.Cs/c1-2-6(1)5-7-3-4-8-6;;/h7-8H,1-5H2;1H3;/q;-1;+1.
What are the key properties of cesium;carbanide;4,7-diazaspiro[2.5]octane?
cesium;carbanide;4,7-diazaspiro[2.5]octane has a molecular weight of 260.12 g/mol, XLogP of -2.83, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cesium;carbanide;4,7-diazaspiro[2.5]octane is sourced from PubChem (CID 168976829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).