C5H12Cl2N2 — CID 175669593
1,6-diazaspiro[3.3]heptane;dihydrochloride (PubChem CID 175669593) has the molecular formula C5H12Cl2N2 and a molecular weight of 171.07 g/mol. Its IUPAC name is 1,6-diazaspiro[3.3]heptane;dihydrochloride.
| Compound Name | 1,6-diazaspiro[3.3]heptane;dihydrochloride |
|---|---|
| PubChem CID | 175669593 |
| Molecular Formula | C5H12Cl2N2 |
| Molecular Weight | 171.07 g/mol |
| Exact Mass | 170.04 |
| IUPAC Name | 1,6-diazaspiro[3.3]heptane;dihydrochloride |
| SMILES | C1CC2(CNC2)N1.Cl.Cl |
| InChI | InChI=1S/C5H10N2.2ClH/c1-2-7-5(1)3-6-4-5;;/h6-7H,1-4H2;2*1H |
| InChIKey | NXBOVIKGFTWFQA-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.07 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |