C5H10N2 — CID 21263412
1,6-diazaspiro[3.3]heptane (PubChem CID 21263412) has the molecular formula C5H10N2 and a molecular weight of 98.15 g/mol. Its IUPAC name is 1,6-diazaspiro[3.3]heptane.
| Compound Name | 1,6-diazaspiro[3.3]heptane |
|---|---|
| PubChem CID | 21263412 |
| Molecular Formula | C5H10N2 |
| Molecular Weight | 98.15 g/mol |
| Exact Mass | 98.08 |
| IUPAC Name | 1,6-diazaspiro[3.3]heptane |
| SMILES | C1CC2(CNC2)N1 |
| InChI | InChI=1S/C5H10N2/c1-2-7-5(1)3-6-4-5/h6-7H,1-4H2 |
| InChIKey | UQPXYEYBUROSJF-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 98.15 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |