C11H22N4 — CID 71358690
2,4,10,13-tetrazadispiro[4.1.57.35]pentadecane (PubChem CID 71358690) has the molecular formula C11H22N4 and a molecular weight of 210.32 g/mol. Its IUPAC name is 2,4,10,13-tetrazadispiro[4.1.57.35]pentadecane.
| Compound Name | 2,4,10,13-tetrazadispiro[4.1.57.35]pentadecane |
|---|---|
| PubChem CID | 71358690 |
| Molecular Formula | C11H22N4 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.18 |
| IUPAC Name | 2,4,10,13-tetrazadispiro[4.1.57.35]pentadecane |
| SMILES | C1CC2(CCN1)CC1(CCN2)CNCN1 |
| InChI | InChI=1S/C11H22N4/c1-4-12-5-2-10(1)7-11(3-6-14-10)8-13-9-15-11/h12-15H,1-9H2 |
| InChIKey | ABTFOMSAWFXGTL-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |