C5H12NO2S+ — CID 7059068
[(3R)-3-methyl-1,1-dioxothiolan-3-yl]azanium (PubChem CID 7059068) has the molecular formula C5H12NO2S+ and a molecular weight of 150.22 g/mol. Its IUPAC name is [(3R)-3-methyl-1,1-dioxothiolan-3-yl]azanium.
| Compound Name | [(3R)-3-methyl-1,1-dioxothiolan-3-yl]azanium |
|---|---|
| PubChem CID | 7059068 |
| Molecular Formula | C5H12NO2S+ |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.06 |
| IUPAC Name | [(3R)-3-methyl-1,1-dioxothiolan-3-yl]azanium |
| SMILES | C[C@@]1([NH3+])CCS(=O)(=O)C1 |
| InChI | InChI=1S/C5H11NO2S/c1-5(6)2-3-9(7,8)4-5/h2-4,6H2,1H3/p+1/t5-/m1/s1 |
| InChIKey | QDUADYISMMMVLN-RXMQYKEDSA-O |
| XLogP | -1.19 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |