C7H15NO3S — CID 7059103
2-[[(3S)-3-methyl-1,1-dioxothiolan-3-yl]amino]ethanol (PubChem CID 7059103) has the molecular formula C7H15NO3S and a molecular weight of 193.27 g/mol. Its IUPAC name is 2-[[(3S)-3-methyl-1,1-dioxothiolan-3-yl]amino]ethanol.
| Compound Name | 2-[[(3S)-3-methyl-1,1-dioxothiolan-3-yl]amino]ethanol |
|---|---|
| PubChem CID | 7059103 |
| Molecular Formula | C7H15NO3S |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.08 |
| IUPAC Name | 2-[[(3S)-3-methyl-1,1-dioxothiolan-3-yl]amino]ethanol |
| SMILES | C[C@]1(NCCO)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C7H15NO3S/c1-7(8-3-4-9)2-5-12(10,11)6-7/h8-9H,2-6H2,1H3/t7-/m0/s1 |
| InChIKey | SYXGZQKBWXSACH-ZETCQYMHSA-N |
| XLogP | -0.85 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |