About 3-[[(3S)-3-methyl-1,1-dioxothiolan-3-yl]amino]propanoic acid
3-[[(3S)-3-methyl-1,1-dioxothiolan-3-yl]amino]propanoic acid (PubChem CID 129366944) has the molecular formula C8H15NO4S
and a molecular weight of 221.28 g/mol. Its IUPAC name is 3-[[(3S)-3-methyl-1,1-dioxothiolan-3-yl]amino]propanoic acid.
Analyze 3-[[(3S)-3-methyl-1,1-dioxothiolan-3-yl]amino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(3S)-3-methyl-1,1-dioxothiolan-3-yl]amino]propanoic acid?
The IUPAC name of 3-[[(3S)-3-methyl-1,1-dioxothiolan-3-yl]amino]propanoic acid (CID 129366944) is 3-[[(3S)-3-methyl-1,1-dioxothiolan-3-yl]amino]propanoic acid.
What is the SMILES notation for 3-[[(3S)-3-methyl-1,1-dioxothiolan-3-yl]amino]propanoic acid?
The canonical SMILES for 3-[[(3S)-3-methyl-1,1-dioxothiolan-3-yl]amino]propanoic acid is C[C@]1(NCCC(=O)O)CCS(=O)(=O)C1.
What is the InChIKey of 3-[[(3S)-3-methyl-1,1-dioxothiolan-3-yl]amino]propanoic acid?
The InChIKey is GXYVEEFLZPJUPV-QMMMGPOBSA-N. The full InChI is InChI=1S/C8H15NO4S/c1-8(9-4-2-7(10)11)3-5-14(12,13)6-8/h9H,2-6H2,1H3,(H,10,11)/t8-/m0/s1.
What are the key properties of 3-[[(3S)-3-methyl-1,1-dioxothiolan-3-yl]amino]propanoic acid?
3-[[(3S)-3-methyl-1,1-dioxothiolan-3-yl]amino]propanoic acid has a molecular weight of 221.28 g/mol, XLogP of -0.37, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(3S)-3-methyl-1,1-dioxothiolan-3-yl]amino]propanoic acid is sourced from PubChem (CID 129366944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).