C3H5F2N — CID 68750416
2,2-difluoroazetidine (PubChem CID 68750416) has the molecular formula C3H5F2N and a molecular weight of 93.08 g/mol. Its IUPAC name is 2,2-difluoroazetidine.
| Compound Name | 2,2-difluoroazetidine |
|---|---|
| PubChem CID | 68750416 |
| Molecular Formula | C3H5F2N |
| Molecular Weight | 93.08 g/mol |
| Exact Mass | 93.04 |
| IUPAC Name | 2,2-difluoroazetidine |
| SMILES | FC1(F)CCN1 |
| InChI | InChI=1S/C3H5F2N/c4-3(5)1-2-6-3/h6H,1-2H2 |
| InChIKey | WROPAPHTEWTSOO-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 93.08 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|