About 2,2-difluoroazetidine
2,2-difluoroazetidine (PubChem CID 68750416) has the molecular formula C3H5F2N
and a molecular weight of 93.08 g/mol. Its IUPAC name is 2,2-difluoroazetidine.
Molecular Properties
| Compound Name | 2,2-difluoroazetidine |
| PubChem CID | 68750416 |
| Molecular Formula | C3H5F2N |
| Molecular Weight | 93.08 g/mol |
| Exact Mass | 93.04 |
| IUPAC Name | 2,2-difluoroazetidine |
| SMILES | FC1(F)CCN1 |
| InChI | InChI=1S/C3H5F2N/c4-3(5)1-2-6-3/h6H,1-2H2 |
| InChIKey | WROPAPHTEWTSOO-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 93.08 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2,2-difluoroazetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoroazetidine?
The IUPAC name of 2,2-difluoroazetidine (CID 68750416) is 2,2-difluoroazetidine.
What is the SMILES notation for 2,2-difluoroazetidine?
The canonical SMILES for 2,2-difluoroazetidine is FC1(F)CCN1.
What is the InChIKey of 2,2-difluoroazetidine?
The InChIKey is WROPAPHTEWTSOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5F2N/c4-3(5)1-2-6-3/h6H,1-2H2.
What are the key properties of 2,2-difluoroazetidine?
2,2-difluoroazetidine has a molecular weight of 93.08 g/mol, XLogP of 0.57, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoroazetidine is sourced from PubChem (CID 68750416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).