C3F6O5S2 — CID 20749597
3,3,4,4,5,5-hexafluoro-1,2,6-oxadithiane 2,2,6,6-tetraoxide (PubChem CID 20749597) has the molecular formula C3F6O5S2 and a molecular weight of 294.15 g/mol. Its IUPAC name is 3,3,4,4,5,5-hexafluoro-1,2,6-oxadithiane 2,2,6,6-tetraoxide.
| Compound Name | 3,3,4,4,5,5-hexafluoro-1,2,6-oxadithiane 2,2,6,6-tetraoxide |
|---|---|
| PubChem CID | 20749597 |
| Molecular Formula | C3F6O5S2 |
| Molecular Weight | 294.15 g/mol |
| Exact Mass | 293.91 |
| IUPAC Name | 3,3,4,4,5,5-hexafluoro-1,2,6-oxadithiane 2,2,6,6-tetraoxide |
| SMILES | O=S1(=O)OS(=O)(=O)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C3F6O5S2/c4-1(5)2(6,7)15(10,11)14-16(12,13)3(1,8)9 |
| InChIKey | PBKGPRZNFXSZDR-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.15 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|