C5H3F8NO4S2 — CID 58997839
4,4,5,5,6,6,7,7-octafluoro-2-methyl-1,3,2-dithiazepane 1,1,3,3-tetraoxide (PubChem CID 58997839) has the molecular formula C5H3F8NO4S2 and a molecular weight of 357.20 g/mol. Its IUPAC name is 4,4,5,5,6,6,7,7-octafluoro-2-methyl-1,3,2-dithiazepane 1,1,3,3-tetraoxide.
| Compound Name | 4,4,5,5,6,6,7,7-octafluoro-2-methyl-1,3,2-dithiazepane 1,1,3,3-tetraoxide |
|---|---|
| PubChem CID | 58997839 |
| Molecular Formula | C5H3F8NO4S2 |
| Molecular Weight | 357.20 g/mol |
| Exact Mass | 356.94 |
| IUPAC Name | 4,4,5,5,6,6,7,7-octafluoro-2-methyl-1,3,2-dithiazepane 1,1,3,3-tetraoxide |
| SMILES | CN1S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)S1(=O)=O |
| InChI | InChI=1S/C5H3F8NO4S2/c1-14-19(15,16)4(10,11)2(6,7)3(8,9)5(12,13)20(14,17)18/h1H3 |
| InChIKey | UVQCFPCSPAVQET-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.20 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|