C8H17NO4S2 — CID 155311776
2,4,4,6,6-pentamethyl-1,3,2-dithiazinane 1,1,3,3-tetraoxide (PubChem CID 155311776) has the molecular formula C8H17NO4S2 and a molecular weight of 255.36 g/mol. Its IUPAC name is 2,4,4,6,6-pentamethyl-1,3,2-dithiazinane 1,1,3,3-tetraoxide.
| Compound Name | 2,4,4,6,6-pentamethyl-1,3,2-dithiazinane 1,1,3,3-tetraoxide |
|---|---|
| PubChem CID | 155311776 |
| Molecular Formula | C8H17NO4S2 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | 2,4,4,6,6-pentamethyl-1,3,2-dithiazinane 1,1,3,3-tetraoxide |
| SMILES | CN1S(=O)(=O)C(C)(C)CC(C)(C)S1(=O)=O |
| InChI | InChI=1S/C8H17NO4S2/c1-7(2)6-8(3,4)15(12,13)9(5)14(7,10)11/h6H2,1-5H3 |
| InChIKey | RRKFVSNDHULPME-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |