C11H14BrNO2S — CID 84644770
6-bromo-2,2,4-trimethyl-3H-1λ6,4-benzothiazine 1,1-dioxide (PubChem CID 84644770) has the molecular formula C11H14BrNO2S and a molecular weight of 304.21 g/mol. Its IUPAC name is 6-bromo-2,2,4-trimethyl-3H-1λ6,4-benzothiazine 1,1-dioxide.
| Compound Name | 6-bromo-2,2,4-trimethyl-3H-1λ6,4-benzothiazine 1,1-dioxide |
|---|---|
| PubChem CID | 84644770 |
| Molecular Formula | C11H14BrNO2S |
| Molecular Weight | 304.21 g/mol |
| Exact Mass | 302.99 |
| IUPAC Name | 6-bromo-2,2,4-trimethyl-3H-1λ6,4-benzothiazine 1,1-dioxide |
| SMILES | CN1CC(C)(C)S(=O)(=O)c2ccc(Br)cc21 |
| InChI | InChI=1S/C11H14BrNO2S/c1-11(2)7-13(3)9-6-8(12)4-5-10(9)16(11,14)15/h4-6H,7H2,1-3H3 |
| InChIKey | WWWPCPDWIUYWPH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.21 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |