5-bromo-1,3-dimethyl-2H-indole-3-carboxylic acid

C11H12BrNO2 — CID 156819150

IUPAC5-bromo-1,3-dimethyl-2H-indole-3-carboxylic acid
SMILESCN1CC(C)(C(=O)O)c2cc(Br)ccc21
InChIInChI=1S/C11H12BrNO2/c1-11(10(14)15)6-13(2)9-4-3-7(12)5-8(9)11/h3-5H,6H2,1-2H3,(H,14,15)
InChIKeyQYBZGRQHMVVMLM-UHFFFAOYSA-N
MW270.13 g/mol
LogP2.24
Rot. Bonds1

About 5-bromo-1,3-dimethyl-2H-indole-3-carboxylic acid

5-bromo-1,3-dimethyl-2H-indole-3-carboxylic acid (PubChem CID 156819150) has the molecular formula C11H12BrNO2 and a molecular weight of 270.13 g/mol. Its IUPAC name is 5-bromo-1,3-dimethyl-2H-indole-3-carboxylic acid.

Molecular Properties

Compound Name5-bromo-1,3-dimethyl-2H-indole-3-carboxylic acid
PubChem CID156819150
Molecular FormulaC11H12BrNO2
Molecular Weight270.13 g/mol
Exact Mass269.01
IUPAC Name5-bromo-1,3-dimethyl-2H-indole-3-carboxylic acid
SMILESCN1CC(C)(C(=O)O)c2cc(Br)ccc21
InChIInChI=1S/C11H12BrNO2/c1-11(10(14)15)6-13(2)9-4-3-7(12)5-8(9)11/h3-5H,6H2,1-2H3,(H,14,15)
InChIKeyQYBZGRQHMVVMLM-UHFFFAOYSA-N
XLogP2.24
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500270.13
LogP ≤ 52.24
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 5-bromo-1,3-dimethyl-2H-indole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-bromo-1,3-dimethyl-2H-indole-3-carboxylic acid?
The IUPAC name of 5-bromo-1,3-dimethyl-2H-indole-3-carboxylic acid (CID 156819150) is 5-bromo-1,3-dimethyl-2H-indole-3-carboxylic acid.
What is the SMILES notation for 5-bromo-1,3-dimethyl-2H-indole-3-carboxylic acid?
The canonical SMILES for 5-bromo-1,3-dimethyl-2H-indole-3-carboxylic acid is CN1CC(C)(C(=O)O)c2cc(Br)ccc21.
What is the InChIKey of 5-bromo-1,3-dimethyl-2H-indole-3-carboxylic acid?
The InChIKey is QYBZGRQHMVVMLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12BrNO2/c1-11(10(14)15)6-13(2)9-4-3-7(12)5-8(9)11/h3-5H,6H2,1-2H3,(H,14,15).
What are the key properties of 5-bromo-1,3-dimethyl-2H-indole-3-carboxylic acid?
5-bromo-1,3-dimethyl-2H-indole-3-carboxylic acid has a molecular weight of 270.13 g/mol, XLogP of 2.24, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-1,3-dimethyl-2H-indole-3-carboxylic acid is sourced from PubChem (CID 156819150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).