C22H35BrN2O3 — CID 143192754
acetaldehyde;tert-butyl 5-bromo-1-methylspiro[2H-indole-3,4'-piperidine]-1'-carboxylate;ethane (PubChem CID 143192754) has the molecular formula C22H35BrN2O3 and a molecular weight of 455.44 g/mol. Its IUPAC name is acetaldehyde;tert-butyl 5-bromo-1-methylspiro[2H-indole-3,4'-piperidine]-1'-carboxylate;ethane.
| Compound Name | acetaldehyde;tert-butyl 5-bromo-1-methylspiro[2H-indole-3,4'-piperidine]-1'-carboxylate;ethane |
|---|---|
| PubChem CID | 143192754 |
| Molecular Formula | C22H35BrN2O3 |
| Molecular Weight | 455.44 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | acetaldehyde;tert-butyl 5-bromo-1-methylspiro[2H-indole-3,4'-piperidine]-1'-carboxylate;ethane |
| SMILES | CC.CC=O.CN1CC2(CCN(C(=O)OC(C)(C)C)CC2)c2cc(Br)ccc21 |
| InChI | InChI=1S/C18H25BrN2O2.C2H4O.C2H6/c1-17(2,3)23-16(22)21-9-7-18(8-10-21)12-20(4)15-6-5-13(19)11-14(15)18;1-2-3;1-2/h5-6,11H,7-10,12H2,1-4H3;2H,1H3;1-2H3 |
| InChIKey | QSJSCENEKUVGFY-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.44 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|