C2F2O7S2 — CID 58781637
3,3-difluoro-2,2,4,4-tetraoxo-1,5,2,4-dioxadithian-6-one (PubChem CID 58781637) has the molecular formula C2F2O7S2 and a molecular weight of 238.14 g/mol. Its IUPAC name is 3,3-difluoro-2,2,4,4-tetraoxo-1,5,2,4-dioxadithian-6-one.
| Compound Name | 3,3-difluoro-2,2,4,4-tetraoxo-1,5,2,4-dioxadithian-6-one |
|---|---|
| PubChem CID | 58781637 |
| Molecular Formula | C2F2O7S2 |
| Molecular Weight | 238.14 g/mol |
| Exact Mass | 237.91 |
| IUPAC Name | 3,3-difluoro-2,2,4,4-tetraoxo-1,5,2,4-dioxadithian-6-one |
| SMILES | O=C1OS(=O)(=O)C(F)(F)S(=O)(=O)O1 |
| InChI | InChI=1S/C2F2O7S2/c3-2(4)12(6,7)10-1(5)11-13(2,8)9 |
| InChIKey | KHXSOXZLUKSITJ-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.14 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|