C8F16O5S — CID 134882125
3,4-difluoro-3,4-bis(1,1,2,2,3,3,3-heptafluoropropoxy)oxathietane 2,2-dioxide (PubChem CID 134882125) has the molecular formula C8F16O5S and a molecular weight of 512.12 g/mol. Its IUPAC name is 3,4-difluoro-3,4-bis(1,1,2,2,3,3,3-heptafluoropropoxy)oxathietane 2,2-dioxide.
| Compound Name | 3,4-difluoro-3,4-bis(1,1,2,2,3,3,3-heptafluoropropoxy)oxathietane 2,2-dioxide |
|---|---|
| PubChem CID | 134882125 |
| Molecular Formula | C8F16O5S |
| Molecular Weight | 512.12 g/mol |
| Exact Mass | 511.92 |
| IUPAC Name | 3,4-difluoro-3,4-bis(1,1,2,2,3,3,3-heptafluoropropoxy)oxathietane 2,2-dioxide |
| SMILES | O=S1(=O)OC(F)(OC(F)(F)C(F)(F)C(F)(F)F)C1(F)OC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8F16O5S/c9-1(10,3(13,14)15)5(19,20)27-7(23)8(24,30(25,26)29-7)28-6(21,22)2(11,12)4(16,17)18 |
| InChIKey | MHTFEQZSKFWPCR-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.12 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|