C3ClF7O3S — CID 24972775
1-chlorosulfonyloxy-1,1,2,2,3,3,3-heptafluoropropane (PubChem CID 24972775) has the molecular formula C3ClF7O3S and a molecular weight of 284.54 g/mol. Its IUPAC name is 1-chlorosulfonyloxy-1,1,2,2,3,3,3-heptafluoropropane.
| Compound Name | 1-chlorosulfonyloxy-1,1,2,2,3,3,3-heptafluoropropane |
|---|---|
| PubChem CID | 24972775 |
| Molecular Formula | C3ClF7O3S |
| Molecular Weight | 284.54 g/mol |
| Exact Mass | 283.91 |
| IUPAC Name | 1-chlorosulfonyloxy-1,1,2,2,3,3,3-heptafluoropropane |
| SMILES | O=S(=O)(Cl)OC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C3ClF7O3S/c4-15(12,13)14-3(10,11)1(5,6)2(7,8)9 |
| InChIKey | JJEZBMMLIYIXRH-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.54 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|