C4Cl3F7O3S — CID 169224042
1,2-dichloro-1-chlorosulfonyloxy-1,2,3,3,4,4,4-heptafluorobutane (PubChem CID 169224042) has the molecular formula C4Cl3F7O3S and a molecular weight of 367.45 g/mol. Its IUPAC name is 1,2-dichloro-1-chlorosulfonyloxy-1,2,3,3,4,4,4-heptafluorobutane.
| Compound Name | 1,2-dichloro-1-chlorosulfonyloxy-1,2,3,3,4,4,4-heptafluorobutane |
|---|---|
| PubChem CID | 169224042 |
| Molecular Formula | C4Cl3F7O3S |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 365.85 |
| IUPAC Name | 1,2-dichloro-1-chlorosulfonyloxy-1,2,3,3,4,4,4-heptafluorobutane |
| SMILES | O=S(=O)(Cl)OC(F)(Cl)C(F)(Cl)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4Cl3F7O3S/c5-1(8,2(9,10)4(12,13)14)3(6,11)17-18(7,15)16 |
| InChIKey | UETVWVKXGLFIJK-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|