C4H3F7O3S — CID 87623488
1,1,2,2,3,3,3-heptafluoropropyl methanesulfonate (PubChem CID 87623488) has the molecular formula C4H3F7O3S and a molecular weight of 264.12 g/mol. Its IUPAC name is 1,1,2,2,3,3,3-heptafluoropropyl methanesulfonate.
| Compound Name | 1,1,2,2,3,3,3-heptafluoropropyl methanesulfonate |
|---|---|
| PubChem CID | 87623488 |
| Molecular Formula | C4H3F7O3S |
| Molecular Weight | 264.12 g/mol |
| Exact Mass | 263.97 |
| IUPAC Name | 1,1,2,2,3,3,3-heptafluoropropyl methanesulfonate |
| SMILES | CS(=O)(=O)OC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4H3F7O3S/c1-15(12,13)14-4(10,11)2(5,6)3(7,8)9/h1H3 |
| InChIKey | QCGLXXANHVXCKL-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.12 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|