About sodium;hydride;trifluoromethyl methanesulfonate
sodium;hydride;trifluoromethyl methanesulfonate (PubChem CID 174543711) has the molecular formula C2H4F3NaO3S
and a molecular weight of 188.10 g/mol. Its IUPAC name is sodium;hydride;trifluoromethyl methanesulfonate.
Molecular Properties
| Compound Name | sodium;hydride;trifluoromethyl methanesulfonate |
| PubChem CID | 174543711 |
| Molecular Formula | C2H4F3NaO3S |
| Molecular Weight | 188.10 g/mol |
| Exact Mass | 187.97 |
| IUPAC Name | sodium;hydride;trifluoromethyl methanesulfonate |
| SMILES | CS(=O)(=O)OC(F)(F)F.[H-].[Na+] |
| InChI | InChI=1S/C2H3F3O3S.Na.H/c1-9(6,7)8-2(3,4)5;;/h1H3;;/q;+1;-1 |
| InChIKey | PTCHKDQLEIHGTI-UHFFFAOYSA-N |
| XLogP | -2.40 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.10 |
| LogP ≤ 5 | -2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;trifluoromethyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;trifluoromethyl methanesulfonate?
The IUPAC name of sodium;hydride;trifluoromethyl methanesulfonate (CID 174543711) is sodium;hydride;trifluoromethyl methanesulfonate.
What is the SMILES notation for sodium;hydride;trifluoromethyl methanesulfonate?
The canonical SMILES for sodium;hydride;trifluoromethyl methanesulfonate is CS(=O)(=O)OC(F)(F)F.[H-].[Na+].
What is the InChIKey of sodium;hydride;trifluoromethyl methanesulfonate?
The InChIKey is PTCHKDQLEIHGTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H3F3O3S.Na.H/c1-9(6,7)8-2(3,4)5;;/h1H3;;/q;+1;-1.
What are the key properties of sodium;hydride;trifluoromethyl methanesulfonate?
sodium;hydride;trifluoromethyl methanesulfonate has a molecular weight of 188.10 g/mol, XLogP of -2.40, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;trifluoromethyl methanesulfonate is sourced from PubChem (CID 174543711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).