C7H10BF3O4S — CID 153335895
CID 153335895 (PubChem CID 153335895) has the molecular formula C7H10BF3O4S and a molecular weight of 258.03 g/mol.
| Compound Name | CID 153335895 |
|---|---|
| PubChem CID | 153335895 |
| Molecular Formula | C7H10BF3O4S |
| Molecular Weight | 258.03 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | — |
| SMILES | [B]C(O)(CC1(C(F)(F)F)CC1)OS(C)(=O)=O |
| InChI | InChI=1S/C7H10BF3O4S/c1-16(13,14)15-6(8,12)4-5(2-3-5)7(9,10)11/h12H,2-4H2,1H3 |
| InChIKey | YGYCSPKBEPPWSE-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.03 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|