C7H11F3O3S — CID 139389390
[1,1,2,2-tetradeuterio-2-[1-(trifluoromethyl)cyclopropyl]ethyl] methanesulfonate (PubChem CID 139389390) has the molecular formula C7H11F3O3S and a molecular weight of 236.25 g/mol. Its IUPAC name is [1,1,2,2-tetradeuterio-2-[1-(trifluoromethyl)cyclopropyl]ethyl] methanesulfonate.
| Compound Name | [1,1,2,2-tetradeuterio-2-[1-(trifluoromethyl)cyclopropyl]ethyl] methanesulfonate |
|---|---|
| PubChem CID | 139389390 |
| Molecular Formula | C7H11F3O3S |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | [1,1,2,2-tetradeuterio-2-[1-(trifluoromethyl)cyclopropyl]ethyl] methanesulfonate |
| SMILES | [2H]C([2H])(OS(C)(=O)=O)C([2H])([2H])C1(C(F)(F)F)CC1 |
| InChI | InChI=1S/C7H11F3O3S/c1-14(11,12)13-5-4-6(2-3-6)7(8,9)10/h2-5H2,1H3/i4D2,5D2 |
| InChIKey | XNANEWVIXDXJRA-CQOLUAMGSA-N |
| XLogP | 1.70 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|