[1-(trifluoromethyl)cyclopropyl]methanesulfinyl chloride

C5H6ClF3OS — CID 165461488

IUPAC[1-(trifluoromethyl)cyclopropyl]methanesulfinyl chloride
SMILESO=S(Cl)CC1(C(F)(F)F)CC1
InChIInChI=1S/C5H6ClF3OS/c6-11(10)3-4(1-2-4)5(7,8)9/h1-3H2
InChIKeyDTCFFWGVYWEJRC-UHFFFAOYSA-N
MW206.62 g/mol
LogP2.23
Rot. Bonds2

About [1-(trifluoromethyl)cyclopropyl]methanesulfinyl chloride

[1-(trifluoromethyl)cyclopropyl]methanesulfinyl chloride (PubChem CID 165461488) has the molecular formula C5H6ClF3OS and a molecular weight of 206.62 g/mol. Its IUPAC name is [1-(trifluoromethyl)cyclopropyl]methanesulfinyl chloride.

Molecular Properties

Compound Name[1-(trifluoromethyl)cyclopropyl]methanesulfinyl chloride
PubChem CID165461488
Molecular FormulaC5H6ClF3OS
Molecular Weight206.62 g/mol
Exact Mass205.98
IUPAC Name[1-(trifluoromethyl)cyclopropyl]methanesulfinyl chloride
SMILESO=S(Cl)CC1(C(F)(F)F)CC1
InChIInChI=1S/C5H6ClF3OS/c6-11(10)3-4(1-2-4)5(7,8)9/h1-3H2
InChIKeyDTCFFWGVYWEJRC-UHFFFAOYSA-N
XLogP2.23
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500206.62
LogP ≤ 52.23
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Analyze [1-(trifluoromethyl)cyclopropyl]methanesulfinyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [1-(trifluoromethyl)cyclopropyl]methanesulfinyl chloride?
The IUPAC name of [1-(trifluoromethyl)cyclopropyl]methanesulfinyl chloride (CID 165461488) is [1-(trifluoromethyl)cyclopropyl]methanesulfinyl chloride.
What is the SMILES notation for [1-(trifluoromethyl)cyclopropyl]methanesulfinyl chloride?
The canonical SMILES for [1-(trifluoromethyl)cyclopropyl]methanesulfinyl chloride is O=S(Cl)CC1(C(F)(F)F)CC1.
What is the InChIKey of [1-(trifluoromethyl)cyclopropyl]methanesulfinyl chloride?
The InChIKey is DTCFFWGVYWEJRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6ClF3OS/c6-11(10)3-4(1-2-4)5(7,8)9/h1-3H2.
What are the key properties of [1-(trifluoromethyl)cyclopropyl]methanesulfinyl chloride?
[1-(trifluoromethyl)cyclopropyl]methanesulfinyl chloride has a molecular weight of 206.62 g/mol, XLogP of 2.23, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(trifluoromethyl)cyclopropyl]methanesulfinyl chloride is sourced from PubChem (CID 165461488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).