(1-methylcyclobutyl)methanesulfinyl chloride

C6H11ClOS — CID 165460099

IUPAC(1-methylcyclobutyl)methanesulfinyl chloride
SMILESCC1(CS(=O)Cl)CCC1
InChIInChI=1S/C6H11ClOS/c1-6(3-2-4-6)5-9(7)8/h2-5H2,1H3
InChIKeyJXSDCXBCEBTPOB-UHFFFAOYSA-N
MW166.67 g/mol
LogP2.08
Rot. Bonds2

About (1-methylcyclobutyl)methanesulfinyl chloride

(1-methylcyclobutyl)methanesulfinyl chloride (PubChem CID 165460099) has the molecular formula C6H11ClOS and a molecular weight of 166.67 g/mol. Its IUPAC name is (1-methylcyclobutyl)methanesulfinyl chloride.

Molecular Properties

Compound Name(1-methylcyclobutyl)methanesulfinyl chloride
PubChem CID165460099
Molecular FormulaC6H11ClOS
Molecular Weight166.67 g/mol
Exact Mass166.02
IUPAC Name(1-methylcyclobutyl)methanesulfinyl chloride
SMILESCC1(CS(=O)Cl)CCC1
InChIInChI=1S/C6H11ClOS/c1-6(3-2-4-6)5-9(7)8/h2-5H2,1H3
InChIKeyJXSDCXBCEBTPOB-UHFFFAOYSA-N
XLogP2.08
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500166.67
LogP ≤ 52.08
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Analyze (1-methylcyclobutyl)methanesulfinyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1-methylcyclobutyl)methanesulfinyl chloride?
The IUPAC name of (1-methylcyclobutyl)methanesulfinyl chloride (CID 165460099) is (1-methylcyclobutyl)methanesulfinyl chloride.
What is the SMILES notation for (1-methylcyclobutyl)methanesulfinyl chloride?
The canonical SMILES for (1-methylcyclobutyl)methanesulfinyl chloride is CC1(CS(=O)Cl)CCC1.
What is the InChIKey of (1-methylcyclobutyl)methanesulfinyl chloride?
The InChIKey is JXSDCXBCEBTPOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11ClOS/c1-6(3-2-4-6)5-9(7)8/h2-5H2,1H3.
What are the key properties of (1-methylcyclobutyl)methanesulfinyl chloride?
(1-methylcyclobutyl)methanesulfinyl chloride has a molecular weight of 166.67 g/mol, XLogP of 2.08, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylcyclobutyl)methanesulfinyl chloride is sourced from PubChem (CID 165460099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).