C2F6O6S2 — CID 12665878
1,1,2,2-tetrafluoro-1,2-bis(fluorosulfonyloxy)ethane (PubChem CID 12665878) has the molecular formula C2F6O6S2 and a molecular weight of 298.14 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-1,2-bis(fluorosulfonyloxy)ethane.
| Compound Name | 1,1,2,2-tetrafluoro-1,2-bis(fluorosulfonyloxy)ethane |
|---|---|
| PubChem CID | 12665878 |
| Molecular Formula | C2F6O6S2 |
| Molecular Weight | 298.14 g/mol |
| Exact Mass | 297.90 |
| IUPAC Name | 1,1,2,2-tetrafluoro-1,2-bis(fluorosulfonyloxy)ethane |
| SMILES | O=S(=O)(F)OC(F)(F)C(F)(F)OS(=O)(=O)F |
| InChI | InChI=1S/C2F6O6S2/c3-1(4,13-15(7,9)10)2(5,6)14-16(8,11)12 |
| InChIKey | MDKZCEDZURVGPP-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.14 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|