C4H2F6O6S2 — CID 10471472
2-[difluoro(fluorosulfonyloxy)methyl]-3,3-difluoro-3-fluorosulfonyloxyprop-1-ene (PubChem CID 10471472) has the molecular formula C4H2F6O6S2 and a molecular weight of 324.18 g/mol. Its IUPAC name is 2-[difluoro(fluorosulfonyloxy)methyl]-3,3-difluoro-3-fluorosulfonyloxyprop-1-ene.
| Compound Name | 2-[difluoro(fluorosulfonyloxy)methyl]-3,3-difluoro-3-fluorosulfonyloxyprop-1-ene |
|---|---|
| PubChem CID | 10471472 |
| Molecular Formula | C4H2F6O6S2 |
| Molecular Weight | 324.18 g/mol |
| Exact Mass | 323.92 |
| IUPAC Name | 2-[difluoro(fluorosulfonyloxy)methyl]-3,3-difluoro-3-fluorosulfonyloxyprop-1-ene |
| SMILES | C=C(C(F)(F)OS(=O)(=O)F)C(F)(F)OS(=O)(=O)F |
| InChI | InChI=1S/C4H2F6O6S2/c1-2(3(5,6)15-17(9,11)12)4(7,8)16-18(10,13)14/h1H2 |
| InChIKey | YTNPKCRYZKSUCU-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.18 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|