C5H2F8O3S — CID 10685163
[1,1-difluoro-2-(trifluoromethyl)prop-2-enyl] trifluoromethanesulfonate (PubChem CID 10685163) has the molecular formula C5H2F8O3S and a molecular weight of 294.12 g/mol. Its IUPAC name is [1,1-difluoro-2-(trifluoromethyl)prop-2-enyl] trifluoromethanesulfonate.
| Compound Name | [1,1-difluoro-2-(trifluoromethyl)prop-2-enyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10685163 |
| Molecular Formula | C5H2F8O3S |
| Molecular Weight | 294.12 g/mol |
| Exact Mass | 293.96 |
| IUPAC Name | [1,1-difluoro-2-(trifluoromethyl)prop-2-enyl] trifluoromethanesulfonate |
| SMILES | C=C(C(F)(F)F)C(F)(F)OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C5H2F8O3S/c1-2(3(6,7)8)4(9,10)16-17(14,15)5(11,12)13/h1H2 |
| InChIKey | BWPZLWWKFWMJNK-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.12 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|