C8H2F16O5S — CID 139713803
(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro-1,1-dihydroxyheptyl) trifluoromethanesulfonate (PubChem CID 139713803) has the molecular formula C8H2F16O5S and a molecular weight of 514.13 g/mol. Its IUPAC name is (2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro-1,1-dihydroxyheptyl) trifluoromethanesulfonate.
| Compound Name | (2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro-1,1-dihydroxyheptyl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 139713803 |
| Molecular Formula | C8H2F16O5S |
| Molecular Weight | 514.13 g/mol |
| Exact Mass | 513.94 |
| IUPAC Name | (2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro-1,1-dihydroxyheptyl) trifluoromethanesulfonate |
| SMILES | O=S(=O)(OC(O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H2F16O5S/c9-1(10,2(11,12)4(15,16)6(19,20)21)3(13,14)5(17,18)7(25,26)29-30(27,28)8(22,23)24/h25-26H |
| InChIKey | WSYLGGMNASAAIA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.13 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|