C11H2F22O3S — CID 91131114
1,1,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecyl trifluoromethanesulfonate (PubChem CID 91131114) has the molecular formula C11H2F22O3S and a molecular weight of 632.16 g/mol. Its IUPAC name is 1,1,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecyl trifluoromethanesulfonate.
| Compound Name | 1,1,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 91131114 |
| Molecular Formula | C11H2F22O3S |
| Molecular Weight | 632.16 g/mol |
| Exact Mass | 631.94 |
| IUPAC Name | 1,1,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecyl trifluoromethanesulfonate |
| SMILES | O=S(=O)(OC(F)(F)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H2F22O3S/c12-2(13,1-3(14,15)36-37(34,35)11(31,32)33)4(16,17)5(18,19)6(20,21)7(22,23)8(24,25)9(26,27)10(28,29)30/h1H2 |
| InChIKey | MLKOXLINJOTRKR-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.16 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|