C12H2F24O4S — CID 18995437
[2,2,3,3-tetrafluoro-3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctoxy)propyl] trifluoromethanesulfonate (PubChem CID 18995437) has the molecular formula C12H2F24O4S and a molecular weight of 698.16 g/mol. Its IUPAC name is [2,2,3,3-tetrafluoro-3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctoxy)propyl] trifluoromethanesulfonate.
| Compound Name | [2,2,3,3-tetrafluoro-3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctoxy)propyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 18995437 |
| Molecular Formula | C12H2F24O4S |
| Molecular Weight | 698.16 g/mol |
| Exact Mass | 697.93 |
| IUPAC Name | [2,2,3,3-tetrafluoro-3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctoxy)propyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(OCC(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H2F24O4S/c13-2(14,1-39-41(37,38)12(34,35)36)10(30,31)40-11(32,33)8(25,26)6(21,22)4(17,18)3(15,16)5(19,20)7(23,24)9(27,28)29/h1H2 |
| InChIKey | SXWZIOSBILPZIT-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.16 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|