C6H3F11O6S — CID 174345703
[2-fluoro-1-hydroxy-1-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethyl] trifluoromethanesulfonate (PubChem CID 174345703) has the molecular formula C6H3F11O6S and a molecular weight of 412.13 g/mol. Its IUPAC name is [2-fluoro-1-hydroxy-1-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethyl] trifluoromethanesulfonate.
| Compound Name | [2-fluoro-1-hydroxy-1-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 174345703 |
| Molecular Formula | C6H3F11O6S |
| Molecular Weight | 412.13 g/mol |
| Exact Mass | 411.95 |
| IUPAC Name | [2-fluoro-1-hydroxy-1-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(OC(O)(CF)OC(F)(F)C(F)(F)OC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H3F11O6S/c7-1-2(18,23-24(19,20)6(15,16)17)21-3(8,9)4(10,11)22-5(12,13)14/h18H,1H2 |
| InChIKey | APQLEWKMABCKPH-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.13 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|